For research use only. Not for therapeutic Use.
Cnicin(CAT: I040700) is a naturally occurring sesquiterpene lactone primarily extracted from Cnicus benedictus (blessed thistle). Known for its bitter taste and bioactive properties, Cnicin exhibits notable anti-inflammatory, antimicrobial, and anticancer activities. It acts by modulating inflammatory pathways and inducing apoptosis in various cancer cell lines, making it a valuable compound in immunology and oncology research. Additionally, Cnicin has been traditionally used to stimulate appetite and digestion due to its bitter tonic effect. Its ability to interact with cellular signaling mechanisms also highlights its potential as a lead compound in developing plant-based therapeutic agents.
| CAS Number | 24394-09-0 |
| Synonyms | [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (3R)-3,4-dihydroxy-2-methylidenebutanoate |
| Molecular Formula | C20H26O7 |
| Purity | ≥95% |
| IUPAC Name | [(3aR,4S,6E,10Z,11aR)-10-(hydroxymethyl)-6-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (3R)-3,4-dihydroxy-2-methylidenebutanoate |
| InChI | InChI=1S/C20H26O7/c1-11-5-4-6-14(9-21)8-17-18(13(3)20(25)27-17)16(7-11)26-19(24)12(2)15(23)10-22/h5,8,15-18,21-23H,2-4,6-7,9-10H2,1H3/b11-5+,14-8-/t15-,16-,17+,18+/m0/s1 |
| InChIKey | ZTDFZLVUIVPZDU-QGNHJMHWSA-N |
| SMILES | CC1=CCCC(=CC2C(C(C1)OC(=O)C(=C)C(CO)O)C(=C)C(=O)O2)CO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
