For research use only. Not for therapeutic Use.
CO-1686（Cat No.:I001446）, also known as Osimertinib, is a third-generation, selective inhibitor of the epidermal growth factor receptor (EGFR) tyrosine kinase. It is specifically designed to target EGFR mutations, including the T790M mutation, which often causes resistance to earlier EGFR inhibitors. CO-1686 is primarily used to treat non-small cell lung cancer (NSCLC) with EGFR mutations, particularly in cases of resistance to first- and second-generation EGFR inhibitors. By irreversibly binding to mutant EGFR, it blocks the signaling pathways responsible for cancer cell growth, offering an effective treatment option for resistant NSCLC.
| CAS Number | 1374640-70-6 |
| Synonyms | N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| Molecular Formula | C27H28F3N7O3 |
| Purity | ≥95% |
| Target | Protein Tyrosine Kinase/RTK |
| Solubility | DMSO: ≥ 43 mg/mL |
| Storage | Store at -20°C |
| IC50 | 21.5±1.7 nM (EGFRL858R/T790M); 303.3 ± 26.7 nM (EGFRWT) |
| IUPAC Name | N-[3-[[2-[4-(4-acetylpiperazin-1-yl)-2-methoxyanilino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]phenyl]prop-2-enamide |
| InChI | InChI=1S/C27H28F3N7O3/c1-4-24(39)32-18-6-5-7-19(14-18)33-25-21(27(28,29)30)16-31-26(35-25)34-22-9-8-20(15-23(22)40-3)37-12-10-36(11-13-37)17(2)38/h4-9,14-16H,1,10-13H2,2-3H3,(H,32,39)(H2,31,33,34,35) |
| InChIKey | HUFOZJXAKZVRNJ-UHFFFAOYSA-N |
| SMILES | CC(=O)N1CCN(CC1)C2=CC(=C(C=C2)NC3=NC=C(C(=N3)NC4=CC(=CC=C4)NC(=O)C=C)C(F)(F)F)OC |
