For research use only. Not for therapeutic Use.
Cocinic Acid (Cat.No:M004874) is a chemical compound with applications in the field of pharmaceuticals and agrochemicals. Its unique molecular structure makes it useful in the synthesis of diverse molecules, contributing to drug development and crop protection. Cocinic Acid serves as a valuable intermediate in organic synthesis processes.
CAS Number | 61788-47-4 |
Synonyms | Fatty acids, coco;COCONUT ACID;Coconut oil acid;Cocinic acid;.alpha.-Cocinic acid;3-Benzenedicarboxylic acid, 4-hydroxy-6-methyl-1;Coconut oil fatty acid;Edenor K 8-18 MY |
Molecular Formula | C19H21NO5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (4R,4aR,7S,7aR,12bS)-7-hydroxy-9-methoxy-3-methyl-2,4,4a,7,7a,13-hexahydro-1H-4,12-methanobenzofuro[3,2-e]isoquinoline-11-carboxylic acid |
InChI | InChI=1S/C19H21NO5/c1-20-6-5-19-11-3-4-13(21)17(19)25-16-14(24-2)8-10(18(22)23)9(15(16)19)7-12(11)20/h3-4,8,11-13,17,21H,5-7H2,1-2H3,(H,22,23)/t11-,12+,13-,17-,19-/m0/s1 |
InChIKey | PZKXRDPRLQDAFK-IWKDVGJASA-N |
SMILES | CN1CCC23C4C1CC5=C2C(=C(C=C5C(=O)O)OC)OC3C(C=C4)O |