For research use only. Not for therapeutic Use.
Coenzyme Q2(Cat No.:R033217), also known as ubiquinone-2, is a vital component of the electron transport chain in cellular respiration. This quinone molecule, with a short isoprenoid tail, plays a crucial role in mitochondrial energy production by transferring electrons between complexes in the respiratory chain. Its high purity and stability make it essential for biochemical and pharmacological research, particularly in studying mitochondrial function and oxidative stress. Coenzyme Q2 is valuable in developing therapeutic strategies for mitochondrial disorders and understanding cellular energy metabolism, contributing significantly to advancements in medical and biological sciences.
Catalog Number | R033217 |
CAS Number | 606-06-4 |
Synonyms | (E)-2-(3,7-Dimethyl-2,6-octadienyl)-5,6-dimethoxy-3-methyl-2,5-cyclohexadiene-1,4-dione; 2-[(2E)-3,7-Dimethyl-2,6-octadienyl]-5,6-dimethoxy-3-methyl-2,5-cyclohexadiene-1,4-dione; (E)-2-(3,7-Dimethyl-2,6-octadienyl)-5,6-dimethoxy-3-methyl-p-benzoquino |
Molecular Formula | C19H26O4 |
Purity | ≥95% |
Target | Coenzymes |
Storage | -20°C |
IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C19H26O4/c1-12(2)8-7-9-13(3)10-11-15-14(4)16(20)18(22-5)19(23-6)17(15)21/h8,10H,7,9,11H2,1-6H3/b13-10+ |
InChIKey | SQQWBSBBCSFQGC-JLHYYAGUSA-N |
SMILES | CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)C |