For research use only. Not for therapeutic Use.
Coenzyme Q9 (CoQ9)(Cat No.: R005815 ), also known as ubiquinone-9, is a lipid-soluble antioxidant and an essential component of the mitochondrial electron transport chain. It plays a crucial role in cellular energy production by facilitating the transfer of electrons during oxidative phosphorylation. CoQ9 is structurally similar to CoQ10 but with a shorter isoprenoid tail. While CoQ10 is more widely studied, CoQ9 also shows potential in maintaining mitochondrial function and protecting cells from oxidative damage. Research into its specific roles and therapeutic uses is ongoing.
| CAS Number | 303-97-9 |
| Synonyms | (all-E)-2,3-dimethoxy-5-methyl-6-(3,7,11,15,19,23,27,31,35-nonamethyl-2,6,10,14,18,22,26,30,34-hexatriacontanonaenyl)-2,5-cyclohexadiene-1,4-dione; CoQ9; NSC 226993; Ubiquinone 45; Ubiquinone 9; Ubiquinone Q9; USP Ubiquinone Related Compound A; |
| Molecular Formula | C54H82O4 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Storage | -20°C |
| IUPAC Name | 2,3-dimethoxy-5-methyl-6-[(2E,6E,10E,14E,18E,22E,26E,30E)-3,7,11,15,19,23,27,31,35-nonamethylhexatriaconta-2,6,10,14,18,22,26,30,34-nonaenyl]cyclohexa-2,5-diene-1,4-dione |
| InChI | InChI=1S/C54H82O4/c1-40(2)22-14-23-41(3)24-15-25-42(4)26-16-27-43(5)28-17-29-44(6)30-18-31-45(7)32-19-33-46(8)34-20-35-47(9)36-21-37-48(10)38-39-50-49(11)51(55)53(57-12)54(58-13)52(50)56/h22,24,26,28,30,32,34,36,38H,14-21,23,25,27,29,31,33,35,37,39H2,1-13H3/b41-24+,42-26+,43-28+,44-30+,45-32+,46-34+,47-36+,48-38+ |
| InChIKey | UUGXJSBPSRROMU-ANPIWJOISA-N |
| SMILES | CC1=C(C(=O)C(=C(C1=O)OC)OC)C/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CC/C=C(\C)/CCC=C(C)C |
