For research use only. Not for therapeutic Use.
Columbianedin(CAT: R063594) is a natural compound found in certain plant species. Its mode of action and pharmacological effects involve interactions with cellular receptors and molecular pathways due to its specific chemical structure. Columbianedin has been investigated for its potential bioactivities, including anti-inflammatory, anti-cancer, and antioxidant properties. It also exhibits potential in modulating cellular signaling pathways and enzyme activities. Its applications extend to traditional medicine and natural product research, where it holds promise for various health-related uses.
| CAS Number | 5058-13-9 |
| Synonyms | [S-(Z)]-2-Methyl-2-butenoic Acid, 1-(8,9-Dihydro-2-oxo-2H-furo[2,3-h]-1-benzopyran-8-yl)-1-methylethyl Ester; Columbianadin; 2-Methylcrotonic Acid Ester with (Z)-(S)-8,9-Dihydro-8-(1-hydroxy-1-methylethyl)-2H-furo[2,3-h]-1-benzopyran-2-one; 2H-Furo[ |
| Molecular Formula | C₁₉H₂₀O₅ |
| Purity | ≥95% |
| Target | Apoptosis |
| Storage | -20°C |
| IUPAC Name | 2-[(8S)-2-oxo-8,9-dihydrofuro[2,3-h]chromen-8-yl]propan-2-yl (Z)-2-methylbut-2-enoate |
| InChI | 1S/C19H20O5/c1-5-11(2)18(21)24-19(3,4)15-10-13-14(22-15)8-6-12-7-9-16(20)23-17(12)13/h5-9,15H,10H2,1-4H3/b11-5-/t15-/m0/s1 |
| InChIKey | RIBPWOXWIRQOQ-GHAIFCDISA-N |
| SMILES | C/C=C(/C)\C(=O)OC(C)(C)[C@@H]1CC2=C(O1)C=CC3=C2OC(=O)C=C3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
