For research use only. Not for therapeutic Use.
Coluracetam(Cat No.:I001369)is a nootropic compound known for its potential cognitive-enhancing properties. It belongs to the racetam family and is believed to enhance choline uptake in neurons, thereby boosting acetylcholine levels, which are crucial for memory and learning. Coluracetam has shown promise in improving cognitive function, particularly in conditions like Alzheimer’s disease and major depressive disorder. Additionally, it may enhance visual processing and reduce anxiety. Its unique mechanism of action and potential neuroprotective effects make Coluracetam a valuable subject of ongoing research in cognitive enhancement and neurodegenerative disease treatment.
CAS Number | 135463-81-9 |
Molecular Formula | C19H23N3O3 |
Purity | ≥95% |
Target | Neuronal Signaling |
Solubility | 10 mM in DMSO |
Storage | Store at -20°C |
IUPAC Name | N-(2,3-dimethyl-5,6,7,8-tetrahydrofuro[2,3-b]quinolin-4-yl)-2-(2-oxopyrrolidin-1-yl)acetamide |
InChI | InChI=1S/C19H23N3O3/c1-11-12(2)25-19-17(11)18(13-6-3-4-7-14(13)20-19)21-15(23)10-22-9-5-8-16(22)24/h3-10H2,1-2H3,(H,20,21,23) |
InChIKey | PSPGQHXMUKWNDI-UHFFFAOYSA-N |
SMILES | CC1=C(OC2=NC3=C(CCCC3)C(=C12)NC(=O)CN4CCCC4=O)C |