For research use only. Not for therapeutic Use.
Coniferin(Cat No.:M027241)is a naturally occurring lignin precursor found in various plant species, primarily in gymnosperms like conifers. It is a glycoside of coniferyl alcohol and plays a key role in lignin biosynthesis, which contributes to the structural integrity of plant cell walls. Coniferin is also involved in plant defense mechanisms and stress responses. Due to its role in lignin formation, Coniferin is of interest in plant biology, biochemistry, and biotechnology, particularly for applications in bioenergy and sustainable materials development. Its chemical structure and biosynthetic pathway are essential for understanding plant secondary metabolism.
CAS Number | 124151-33-3 |
Synonyms | trans-Coniferin; Coniferyl alcohol β-glucoside; Coniferyl alcohol 4-O-glucoside; |
Molecular Formula | C16H22O8 |
Purity | ≥95% |
Target | Fungal |
Storage | Store at 4℃ |
IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[4-[(E)-3-hydroxyprop-1-enyl]-2-methoxyphenoxy]oxane-3,4,5-triol |
InChI | InChI=1S/C16H22O8/c1-22-11-7-9(3-2-6-17)4-5-10(11)23-16-15(21)14(20)13(19)12(8-18)24-16/h2-5,7,12-21H,6,8H2,1H3/b3-2+/t12-,13-,14+,15-,16-/m1/s1 |
InChIKey | SFLMUHDGSQZDOW-FAOXUISGSA-N |
SMILES | COC1=C(C=CC(=C1)/C=C/CO)O[C@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |