For research use only. Not for therapeutic Use.
Coniferyl alcohol(Cat No.:R072452) is a natural organic compound classified as a hydroxycinnamyl alcohol. Its mode of action involves being a precursor in the biosynthesis of lignin, a complex polymer responsible for providing structural support in plant cell walls. Pharmacologically, coniferyl alcohol is not commonly used as a drug. However, it holds significant importance in the field of lignin research and biotechnology. It is utilized in enzymatic and microbial transformations to produce valuable chemicals, such as vanillin, and serves as a substrate for various enzymes involved in lignin degradation and bioconversion processes. Additionally, coniferyl alcohol contributes to the aroma and flavor profiles of certain plants and plant-derived products.
CAS Number | 458-35-5 |
Molecular Formula | C10H12O3 |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
IUPAC Name | 4-[(E)-3-hydroxyprop-1-enyl]-2-methoxyphenol |
InChI | InChI=1S/C10H12O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h2-5,7,11-12H,6H2,1H3/b3-2+ |
InChIKey | JMFRWRFFLBVWSI-NSCUHMNNSA-N |
SMILES | COC1=C(C=CC(=C1)/C=C/CO)O |