For research use only. Not for therapeutic Use.
Copper(II) oleate (Cat No.:M051047) is a chemical compound formed by the reaction of copper salts with oleic acid, a fatty acid derived from various plant and animal sources. It has applications as a metal soap and pigment in the fields of coatings, paints, and plastics. With its distinctive blue-green color, copper(II) oleate is used as a drier in oil-based paints to accelerate drying and improve durability. Additionally, it serves as a corrosion inhibitor for metals and as a component in some lubricants.
Catalog Number | M051047 |
CAS Number | 1120-44-1 |
Molecular Formula | C36H66CuO4 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | copper;(Z)-octadec-9-enoate |
InChI | InChI=1S/2C18H34O2.Cu/c2*1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h2*9-10H,2-8,11-17H2,1H3,(H,19,20);/q;;+2/p-2/b2*10-9-; |
InChIKey | SVOAENZIOKPANY-CVBJKYQLSA-L |
SMILES | CCCCCCCCC=CCCCCCCCC(=O)[O-].CCCCCCCCC=CCCCCCCCC(=O)[O-].[Cu+2] |