For research use only. Not for therapeutic Use.
The copper-neocuproine complex(Cat No.:M061537), often referred to in chemical notation as Cu(neocuproine)2, involves the coordination of the copper ion with neocuproine, a bidentate ligand known for its strong chelating ability. This complex is notable for its intense luminescence, which makes it useful in photophysical studies and as a fluorescent marker in various analytical applications. The copper-neocuproine complex is also studied for its electrochemical properties, making it of interest in the development of electrochemical sensors and devices. Its stability and distinctive optical properties are exploited in the field of molecular electronics and sensing technologies.
CAS Number | 14875-91-3 |
Molecular Formula | C28H24CuN4+2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | copper;2,9-dimethyl-1,10-phenanthroline |
InChI | InChI=1S/2C14H12N2.Cu/c2*1-9-3-5-11-7-8-12-6-4-10(2)16-14(12)13(11)15-9;/h2*3-8H,1-2H3;/q;;+2 |
InChIKey | QGMZVDXJVMOGSN-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.CC1=NC2=C(C=C1)C=CC3=C2N=C(C=C3)C.[Cu+2] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |