For research use only. Not for therapeutic Use.
Copper(I) trifluoromethanesulfonate(Cat No.:L026868)is a high-purity organometallic compound widely used in organic synthesis and catalysis. This copper(I) salt, featuring a trifluoromethanesulfonate (triflate) anion, is known for its effectiveness in promoting various chemical transformations, including coupling reactions, cycloadditions, and carbon-carbon bond formations. Its strong Lewis acidity and stability make it a valuable catalyst in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals. Copper(I) trifluoromethanesulfonate is ideal for researchers seeking efficient and selective catalytic processes in advanced chemical research and development.
CAS Number | 42152-44-3 |
Molecular Formula | CCuF3O3S |
Purity | ≥95% |
IUPAC Name | copper(1+);trifluoromethanesulfonate |
InChI | InChI=1S/CHF3O3S.Cu/c2-1(3,4)8(5,6)7;/h(H,5,6,7);/q;+1/p-1 |
InChIKey | YNYHGRUPNQLZHB-UHFFFAOYSA-M |
SMILES | C(F)(F)(F)S(=O)(=O)[O-].[Cu+] |