For research use only. Not for therapeutic Use.
Coprine is a mycotoxin found in certain species of mushrooms, used in biochemical and toxicological research. It inhibits the enzyme acetaldehyde dehydrogenase, leading to adverse reactions when alcohol is consumed. This compound is essential for studying the effects of mycotoxins, enzyme inhibition, and developing safety protocols for mushroom consumption, ensuring precise and reliable results in advanced toxicology studies.
| CAS Number | 58919-61-2 |
| Synonyms | N-(1-hydroxycyclopropyl)-L-glutamine |
| Molecular Formula | C8H14N2O4 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (2S)-2-amino-5-[(1-hydroxycyclopropyl)amino]-5-oxopentanoic acid |
| InChI | InChI=1S/C8H14N2O4/c9-5(7(12)13)1-2-6(11)10-8(14)3-4-8/h5,14H,1-4,9H2,(H,10,11)(H,12,13)/t5-/m0/s1 |
| InChIKey | OEEZRBUCLFMTLD-YFKPBYRVSA-N |
| SMILES | C1CC1(NC(=O)CCC(C(=O)O)N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
