For research use only. Not for therapeutic Use.
(+)-Coronaric acid(Cat No.:M075891) is a natural fatty acid found in certain plants, particularly in the seeds of the tropical tree Annona reticulata. It is characterized by its unique chemical structure, featuring a cyclopropane ring and a carboxylic acid functional group. (+)-Coronaric acid exhibits diverse biological activities, including antifungal and cytotoxic properties, making it of interest in pharmaceutical and agricultural research. Studies suggest its potential in the development of new drugs for treating fungal infections and cancer. Furthermore, its presence in Annona reticulata seeds contributes to the plant’s medicinal and pesticidal properties.
CAS Number | 16833-56-0 |
Molecular Formula | C18H32O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 8-[(2R,3S)-3-[(Z)-oct-2-enyl]oxiran-2-yl]octanoic acid |
InChI | InChI=1S/C18H32O3/c1-2-3-4-5-7-10-13-16-17(21-16)14-11-8-6-9-12-15-18(19)20/h7,10,16-17H,2-6,8-9,11-15H2,1H3,(H,19,20)/b10-7-/t16-,17+/m0/s1 |
InChIKey | FBUKMFOXMZRGRB-SQGUUQMOSA-N |
SMILES | CCCCCC=CCC1C(O1)CCCCCCCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |