For research use only. Not for therapeutic Use.
Coronene(CAT: R015759) is a polycyclic aromatic hydrocarbon (PAH) consisting of six fused benzene rings, forming a planar, symmetrical structure. Known for its high stability and unique electronic properties, Coronene is widely used in materials science, especially in the study of carbon-based nanomaterials, such as graphene and fullerenes. It serves as a model compound for understanding molecular interactions in aromatic systems and plays a role in organic electronics, optoelectronics, and photonics research. Additionally, Coronene’s fluorescence properties make it useful in spectroscopic studies and environmental monitoring of PAHs.
CAS Number | 191-07-1 |
Synonyms | Circumbenzene; NSC 90725 |
Molecular Formula | C24H12 |
Purity | 95% |
Appearance | Yellow to yellow-gold powder or fibrous powder |
Storage | -20°C |
Analysis method | HPLC |
IUPAC Name | coronene |
InChI | InChI=1S/C24H12/c1-2-14-5-6-16-9-11-18-12-10-17-8-7-15-4-3-13(1)19-20(14)22(16)24(18)23(17)21(15)19/h1-12H |
InChIKey | VPUGDVKSAQVFFS-UHFFFAOYSA-N |
SMILES | C1=CC2=C3C4=C1C=CC5=C4C6=C(C=C5)C=CC7=C6C3=C(C=C2)C=C7 |