For research use only. Not for therapeutic Use.
Corticosterone(Cat No.:I003769)is a steroid hormone produced by the adrenal cortex in response to stress, playing a crucial role in regulating the body’s response to stress and maintaining homeostasis. It is a key glucocorticoid in many vertebrates, including rodents, and is involved in processes such as metabolism, immune response, and inflammation. In humans, its counterpart is cortisol. Corticosterone helps regulate blood sugar levels, blood pressure, and immune function. It is often studied in animal models of stress, as it can provide insights into the hormonal regulation of stress responses and related disorders.
Catalog Number | I003769 |
CAS Number | 50-22-6 |
Synonyms | (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-6,7,8,9,10,11,12,13,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-3(2H)-one |
Molecular Formula | C21H30O4 |
Purity | ≥95% |
Target | Vitamin D Related/Nuclear Receptor |
Solubility | 10 mM in DMSO |
Storage | Store at RT |
IUPAC Name | (8S,9S,10R,11S,13S,14S,17S)-11-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
InChI | InChI=1S/C21H30O4/c1-20-8-7-13(23)9-12(20)3-4-14-15-5-6-16(18(25)11-22)21(15,2)10-17(24)19(14)20/h9,14-17,19,22,24H,3-8,10-11H2,1-2H3/t14-,15-,16+,17-,19+,20-,21-/m0/s1 |
InChIKey | OMFXVFTZEKFJBZ-HJTSIMOOSA-N |
SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2[C@H](C[C@]4([C@H]3CC[C@@H]4C(=O)CO)C)O |
Reference | <p style=/line-height:25px/> |