For research use only. Not for therapeutic Use.
Cortodoxone (Cat.No:I001896) is a synthetic corticosteroid commonly used in medical treatments. Its anti-inflammatory properties make it effective in managing various conditions, including allergies, arthritis, and skin disorders. By suppressing the immune system and reducing inflammation, Cortodoxone helps alleviate symptoms and promote healing.
| Catalog Number | I001896 |
| CAS Number | 152-58-9 |
| Molecular Formula | C21H30O4 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-17-hydroxy-17-(2-hydroxyacetyl)-10,13-dimethyl-2,6,7,8,9,11,12,14,15,16-decahydro-1H-cyclopenta[a]phenanthren-3-one |
| InChI | InChI=1S/C21H30O4/c1-19-8-5-14(23)11-13(19)3-4-15-16(19)6-9-20(2)17(15)7-10-21(20,25)18(24)12-22/h11,15-17,22,25H,3-10,12H2,1-2H3/t15-,16+,17+,19+,20+,21+/m1/s1 |
| InChIKey | WHBHBVVOGNECLV-OBQKJFGGSA-N |
| SMILES | C[C@]12CCC(=O)C=C1CC[C@@H]3[C@@H]2CC[C@]4([C@H]3CC[C@@]4(C(=O)CO)O)C |
| Reference | <p style=/line-height:25px/> |
