For research use only. Not for therapeutic Use.
Corydaline (Cat No.:I003878) is a natural alkaloid found in various plants, notably Corydalis Yasuo. It demonstrates analgesic and anti-inflammatory properties by modulating opioid receptors and inhibiting inflammatory mediators. This compound has potential applications in pain management and inflammation-related conditions. Additionally, Corydaline exhibits neuroprotective effects and shows promise in the treatment of neurological disorders. With its diverse pharmacological activities, Corydaline is an intriguing compound for further investigation and development of therapeutic interventions.
| Catalog Number | I003878 |
| CAS Number | 518-69-4 |
| Molecular Formula | C22H27NO4 |
| Purity | ≥95% |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C(protect from light) |
| IUPAC Name | (13S,13aR)-2,3,9,10-tetramethoxy-13-methyl-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinoline |
| InChI | InChI=1S/C22H27NO4/c1-13-15-6-7-18(24-2)22(27-5)17(15)12-23-9-8-14-10-19(25-3)20(26-4)11-16(14)21(13)23/h6-7,10-11,13,21H,8-9,12H2,1-5H3/t13-,21+/m0/s1 |
| InChIKey | VRSRXLJTYQVOHC-YEJXKQKISA-N |
| SMILES | CC1C2C3=CC(=C(C=C3CCN2CC4=C1C=CC(=C4OC)OC)OC)OC |
| Reference | <p style=/line-height:25px/> </p> |
