For research use only. Not for therapeutic Use.
Corydine（Cat No.:R072454）is an isoquinoline alkaloid derived from plants of the Corydalis genus, known for its potential pharmacological activities. It exhibits sedative, analgesic, and anti-inflammatory properties, making it valuable for research into pain management and neurological disorders. Corydine is also studied for its role in modulating neurotransmitter systems, contributing to its effects on the central nervous system. Its natural origin and bioactive profile make it a subject of interest in phytochemistry and drug discovery, particularly for developing treatments for pain and related conditions.
| Catalog Number | R072454 |
| CAS Number | 476-69-7 |
| Molecular Formula | C20H23NO4 |
| Purity | ≥95% |
| Target | Reverse Transcriptase |
| IUPAC Name | (6aS)-2,10,11-trimethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-1-ol |
| InChI | InChI=1S/C20H23NO4/c1-21-8-7-12-10-15(24-3)19(22)18-16(12)13(21)9-11-5-6-14(23-2)20(25-4)17(11)18/h5-6,10,13,22H,7-9H2,1-4H3/t13-/m0/s1 |
| InChIKey | IDQUPXZJURZAGF-ZDUSSCGKSA-N |
| SMILES | CN1CCC2=CC(=C(C3=C2[C@@H]1CC4=C3C(=C(C=C4)OC)OC)O)OC |
