For research use only. Not for therapeutic Use.
Corynoxidine (Cat.No:R066288) is a natural alkaloid derived from Corydalis yanhusuo, a traditional Chinese medicinal plant. It possesses analgesic properties and acts as a dopamine receptor antagonist. Corynoxidine has potential applications in pain management and could contribute to the development of new therapeutic interventions for pain-related conditions.
| Catalog Number | R066288 |
| CAS Number | 57906-85-1 |
| Molecular Formula | C21H25NO5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (7S,13aS)-2,3,9,10-tetramethoxy-7-oxido-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-7-ium |
| InChI | InChI=1S/C21H25NO5/c1-24-18-6-5-13-9-17-15-11-20(26-3)19(25-2)10-14(15)7-8-22(17,23)12-16(13)21(18)27-4/h5-6,10-11,17H,7-9,12H2,1-4H3/t17-,22-/m0/s1 |
| InChIKey | QYEMUDHNCZHUKC-JTSKRJEESA-N |
| SMILES | COC1=C(C2=C(CC3C4=CC(=C(C=C4CC[N+]3(C2)[O-])OC)OC)C=C1)OC |
