For research use only. Not for therapeutic Use.
Corypalmine（Cat No.:R064600）is a naturally occurring alkaloid found in various plant species, including Corydalis and Palmatine-containing plants. It has demonstrated various biological activities, including anti-inflammatory, analgesic, and neuroprotective effects. Research suggests that corypalmine may have potential therapeutic applications in treating conditions like pain, neurological disorders, and inflammatory diseases. The compound acts through modulation of multiple signaling pathways, including anti-inflammatory and antioxidant pathways. Corypalmine is being explored for its pharmacological properties and could serve as a promising lead for the development of novel therapeutic agents in the pharmaceutical industry.
| Catalog Number | R064600 |
| CAS Number | 27313-86-6 |
| Molecular Formula | C20H23NO4 |
| Purity | ≥95% |
| Target | Fungal |
| Storage | 4°C, protect from light |
| IUPAC Name | 2,9,10-trimethoxy-6,8,13,13a-tetrahydro-5H-isoquinolino[2,1-b]isoquinolin-3-ol |
| InChI | InChI=1S/C20H23NO4/c1-23-18-5-4-12-8-16-14-10-19(24-2)17(22)9-13(14)6-7-21(16)11-15(12)20(18)25-3/h4-5,9-10,16,22H,6-8,11H2,1-3H3 |
| InChIKey | BMCZTYDZHNTKPR-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(CC3C4=CC(=C(C=C4CCN3C2)O)OC)C=C1)OC |
