For research use only. Not for therapeutic Use.
Costunolide (CAT: I004060) is a natural sesquiterpene lactone that is found in several medicinal plants, including Saussurea lappa and Magnolia grandiflora. It exhibits various pharmacological activities, including anti-inflammatory, antioxidant, anticancer, and immunomodulatory effects. Costunolide has been studied for its potential therapeutic applications in the treatment of inflammatory diseases, such as rheumatoid arthritis and inflammatory bowel disease. It also shows promise as an anticancer agent, as it has demonstrated cytotoxic effects against various cancer cell lines and exhibits potential in inhibiting cancer cell proliferation and inducing apoptosis. Furthermore, costunolide has been investigated for its neuroprotective and hepatoprotective properties. However, further research is needed to fully understand its mechanisms of action and evaluate its clinical potential.
| CAS Number | 553-21-9 |
| Synonyms | (+)-Costunolide;Costunolid; Costus lactone; NSC 106404; |
| Molecular Formula | C15H20O2 |
| Purity | ≥95% |
| Target | Metabolic Enzyme/Protease |
| Solubility | DMSO > 49 mg/ml |
| Storage | store at -20℃ |
| IC50 | 6.2 - 9.8 ug/mL(sarcoma cells viability) |
| IUPAC Name | (3aS,6E,10E,11aR)-6,10-dimethyl-3-methylidene-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-2-one |
| InChI | 1S/C15H20O2/c1-10-5-4-6-11(2)9-14-13(8-7-10)12(3)15(16)17-14/h5,9,13-14H,3-4,6-8H2,1-2H3/b10-5+,11-9+/t13-,14+/m0/s1 |
| InChIKey | HRYLQFBHBWLLLL-GRFSRWIASA-N |
| SMILES | C/C/1=C\CC/C(=C/[C@@H]2[C@@H](CC1)C(=C)C(=O)O2)/C |
