For research use only. Not for therapeutic Use.
COTI-2 (Cat.No:I006193) is an investigational anticancer drug with promising potential. It targets mutant p53, a common genetic alteration in various cancers, to restore normal function and inhibit tumor growth. Preclinical studies have shown encouraging results, highlighting COTI-2 as a potential therapeutic option for patients with p53-mutated cancers. Clinical trials are underway to evaluate its efficacy and safety in humans.
| Catalog Number | I006193 |
| CAS Number | 1039455-84-9 |
| Synonyms | COTI-2; COTI2; COTI 2;(E)-N/’-(6,7-dihydroquinolin-8(5H)-ylidene)-4-(pyridin-2-yl)piperazine-1-carbothiohydrazide |
| Molecular Formula | C19H22N6S |
| Purity | ≥95% |
| Target | MDM-2/p53 |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | N-(6,7-dihydro-5H-quinolin-8-ylideneamino)-4-pyridin-2-ylpiperazine-1-carbothioamide |
| InChI | InChI=1S/C19H22N6S/c26-19(23-22-16-7-3-5-15-6-4-10-21-18(15)16)25-13-11-24(12-14-25)17-8-1-2-9-20-17/h1-2,4,6,8-10H,3,5,7,11-14H2,(H,23,26)/b22-16+ |
| InChIKey | UTDAKQMBNSHJJB-JWGURIENSA-N |
| SMILES | S=C(N/N=C1C(N=CC=C2)=C2CCC1)N(CC3)CCN3C4=NC=CC=C4 |
