For research use only. Not for therapeutic Use.
Cotinine (Cat No.: I003713) is a naturally occurring alkaloid found in tobacco and serves as the principal metabolite of nicotine. It plays a vital role as a biological indicator in measuring the components of tobacco smoke exposure. Due to its presence in the body following nicotine consumption, cotinine is frequently employed to assess and quantify tobacco use, aiding in research related to smoking habits and exposure.
| Catalog Number | I003713 |
| CAS Number | 486-56-6 |
| Synonyms | (S)-1-methyl-5-(pyridin-3-yl)pyrrolidin-2-one |
| Molecular Formula | C10H12N2O |
| Purity | ≥95% |
| Target | Nicotinic Receptor |
| Solubility | 10 mM in DMSO |
| Storage | 2-8°C |
| IUPAC Name | (5S)-1-methyl-5-pyridin-3-ylpyrrolidin-2-one |
| InChI | InChI=1S/C10H12N2O/c1-12-9(4-5-10(12)13)8-3-2-6-11-7-8/h2-3,6-7,9H,4-5H2,1H3/t9-/m0/s1 |
| InChIKey | UIKROCXWUNQSPJ-VIFPVBQESA-N |
| SMILES | CN1C(CCC1=O)C2=CN=CC=C2 |
| Reference | <p style=/line-height:25px/> |
