Coumarin（Cat No.:A000650） is an aromatic organic compound with a sweet, vanilla-like scent, naturally found in many plants, including tonka beans, lavender, and sweet clover. It is widely used in the fragrance and flavor industries to impart a fresh, sweet aroma and flavor to cosmetics, perfumes, and food products. Besides its use in consumer goods, coumarin also has applications in pharmaceuticals as a precursor in the synthesis of anticoagulant medications like warfarin.
| Catalog Number | A000650 |
| CAS Number | 91-64-5 |
| Synonyms | NA |
| Molecular Formula | C9H6O2 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | chromen-2-one |
| InChI | InChI=1S/C9H6O2/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-6H |
| InChIKey | ZYGHJZDHTFUPRJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=O)O2 |
