For research use only. Not for therapeutic Use.
Coumberol is a fluorescent substrate of AKR1C3 protein. Coumberol can be used for the research of AKR1C3[1].
| Catalog Number | I044991 |
| CAS Number | 878019-53-5 |
| Synonyms | 6-[hydroxy(phenyl)methyl]-3-oxa-13-azatetracyclo[7.7.1.02,7.013,17]heptadeca-1(17),2(7),5,8-tetraen-4-one |
| Molecular Formula | C22H21NO3 |
| Purity | ≥95% |
| InChI | InChI=1S/C22H21NO3/c24-19-13-17(21(25)14-6-2-1-3-7-14)18-12-15-8-4-10-23-11-5-9-16(20(15)23)22(18)26-19/h1-3,6-7,12-13,21,25H,4-5,8-11H2 |
| InChIKey | FXBJCIJXXOXALP-UHFFFAOYSA-N |
| SMILES | C1CC2=CC3=C(C4=C2N(C1)CCC4)OC(=O)C=C3C(C5=CC=CC=C5)O |
| Reference | [1]. Jamieson SM, et al. A novel fluorometric assay for aldo-keto reductase 1C3 predicts metabolic activation of the nitrogen mustard prodrug PR-104A in human leukaemia cells. Biochem Pharmacol. 2014;88(1):36-45. |
