For research use only. Not for therapeutic Use.
Cowaxanthone B(Cat No.:R072455)is a naturally occurring xanthone derivative isolated from Calophyllum species, known for its potential pharmacological properties. This compound has shown promise as an antioxidant and anti-inflammatory agent, with potential therapeutic applications in managing oxidative stress-related disorders and inflammation. Studies suggest that Cowaxanthone B may also exhibit anticancer activity, inhibiting cell proliferation and inducing apoptosis in cancerous cells. Its unique chemical structure, including a xanthone backbone, contributes to its bioactivity, making it a valuable candidate for further research in the development of novel therapeutic agents.
CAS Number | 212842-64-3 |
Molecular Formula | C25H28O6 |
Purity | ≥95% |
Target | Bacterial |
IUPAC Name | 1,3-dihydroxy-6,7-dimethoxy-2,8-bis(3-methylbut-2-enyl)xanthen-9-one |
InChI | InChI=1S/C25H28O6/c1-13(2)7-9-15-17(26)11-18-22(23(15)27)24(28)21-16(10-8-14(3)4)25(30-6)20(29-5)12-19(21)31-18/h7-8,11-12,26-27H,9-10H2,1-6H3 |
InChIKey | BLZDSTHKFQEOIU-UHFFFAOYSA-N |
SMILES | CC(=CCC1=C(C2=C(C=C1O)OC3=CC(=C(C(=C3C2=O)CC=C(C)C)OC)OC)O)C |