For research use only. Not for therapeutic Use.
CP-20961(Cat No.:R053497)is a synthetic small molecule identified as a potent and selective agonist of the thyroid-stimulating hormone receptor (TSHR). By mimicking TSH activity, it stimulates cyclic AMP production and downstream thyroid hormone signaling, making it a valuable research tool in endocrinology. CP-20961 has been investigated for its ability to modulate thyroid function, offering insights into hyperthyroidism, hypothyroidism, and thyroid cancer. Researchers use it to study receptor pharmacology, thyroid hormone regulation, and potential therapeutic approaches targeting TSHR-mediated pathways in endocrine and metabolic disorders.
CAS Number | 35607-20-6 |
Synonyms | 2-[3-(dioctadecylamino)propyl-(2-hydroxyethyl)amino]ethanol |
Molecular Formula | C43H90N2O2 |
Purity | ≥95% |
IUPAC Name | 2-[3-(dioctadecylamino)propyl-(2-hydroxyethyl)amino]ethanol |
InChI | InChI=1S/C43H90N2O2/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-36-44(38-35-39-45(40-42-46)41-43-47)37-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h46-47H,3-43H2,1-2H3 |
InChIKey | WXNRAKRZUCLRBP-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCN(CCCCCCCCCCCCCCCCCC)CCCN(CCO)CCO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |