For research use only. Not for therapeutic Use.
CP 43(CAT: I014307) is a chemical compound known as a potent inhibitor of TAOK (TAO kinase). TAOKs, or thousand-and-one amino acid kinases, are a family of serine/threonine kinases that play important roles in cellular processes such as cell growth, differentiation, and apoptosis. By inhibiting TAOK activity, CP 43 can potentially modulate the signaling pathways controlled by these kinases. The inhibition of TAOKs may have implications for various biological processes and diseases.
| Catalog Number | I014307 |
| CAS Number | 850467-66-2 |
| Synonyms | CP 43; CP43; CP-43;N-(2-Oxo-2-((1,2,3,4-tetrahydronaphthalen-1-yl)amino)ethyl)-[1,1′-biphenyl]-4-carboxamide |
| Molecular Formula | C25H24N2O2 |
| Purity | ≥95% |
| Target | MAP3K |
| Solubility | Soluble in DMSO |
| InChI | InChI=1S/C25H24N2O2/c28-24(27-23-12-6-10-20-9-4-5-11-22(20)23)17-26-25(29)21-15-13-19(14-16-21)18-7-2-1-3-8-18/h1-5,7-9,11,13-16,23H,6,10,12,17H2,(H,26,29)(H,27,28) |
| InChIKey | WQKXOAJVNFOHNZ-UHFFFAOYSA-N |
| SMILES | O=C(C1=CC=C(C2=CC=CC=C2)C=C1)NCC(NC3CCCC4=C3C=CC=C4)=O |
| Reference | </br>Koo et al (2017) Targeting TAO kinase using a new inhibitor compound delays mitosis and induces mitotic cell death in centrosome amplified breast cancer cells. Mol.Cancer Ther. 16 2410 PMID: 28830982 </br> |
