For research use only. Not for therapeutic Use.
CP-447697（Cat No.:I042675）is an experimental small molecule compound being studied for its potential use in cancer therapy. It acts as a potent inhibitor of the phosphoinositide 3-kinase (PI3K) pathway, which plays a crucial role in regulating cell growth, survival, and metabolism. By targeting this pathway, CP-447697 aims to inhibit tumor cell proliferation and induce cell death in various cancer types. Preclinical studies have shown promising results, and ongoing research is focused on evaluating its safety, pharmacokinetics, and therapeutic potential in clinical trials for solid tumors and hematologic malignancies.
| CAS Number | 1092847-21-6 |
| Synonyms | 4-[1-benzothiophene-3-carbonyl-[2-(4-chlorophenyl)ethyl]amino]-N-(2,4-difluorophenyl)piperidine-1-carboxamide |
| Molecular Formula | C29H26ClF2N3O2S |
| Purity | ≥95% |
| IUPAC Name | 4-[1-benzothiophene-3-carbonyl-[2-(4-chlorophenyl)ethyl]amino]-N-(2,4-difluorophenyl)piperidine-1-carboxamide |
| InChI | InChI=1S/C29H26ClF2N3O2S/c30-20-7-5-19(6-8-20)11-16-35(28(36)24-18-38-27-4-2-1-3-23(24)27)22-12-14-34(15-13-22)29(37)33-26-10-9-21(31)17-25(26)32/h1-10,17-18,22H,11-16H2,(H,33,37) |
| InChIKey | UMERSEDFPNHLEN-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N(CCC2=CC=C(C=C2)Cl)C(=O)C3=CSC4=CC=CC=C43)C(=O)NC5=C(C=C(C=C5)F)F |
