For research use only. Not for therapeutic Use.
CP-466722（Cat No.:I000354） is a potent and reversible inhibitor of ATM (ataxia telangiectasia mutated), a protein kinase involved in DNA damage response and repair. Notably, it does not affect ATR (ataxia telangiectasia and Rad3-related) and does not inhibit other members of the PI3K (phosphoinositide 3-kinase) or PIKK (PI3K-related kinase) family. By specifically targeting ATM, CP-466722 holds promise as a valuable tool in studying the cellular functions of ATM and its potential therapeutic applications in diseases related to DNA damage response and genomic instability.
| Catalog Number | I000354 |
| CAS Number | 1080622-86-1 |
| Synonyms | 2-(6,7-dimethoxyquinazolin-4-yl)-5-pyridin-2-yl-1,2,4-triazol-3-amine |
| Molecular Formula | C₁₇H₁₅N₇O₂ |
| Purity | ≥95% |
| Target | ATM/ATR |
| Solubility | DMSO: 0.28 mg/mL, H2O: <1 mg/mL |
| Storage | 2-8°C |
| IUPAC Name | 2-(6,7-dimethoxyquinazolin-4-yl)-5-pyridin-2-yl-1,2,4-triazol-3-amine |
| InChI | InChI=1S/C17H15N7O2/c1-25-13-7-10-12(8-14(13)26-2)20-9-21-16(10)24-17(18)22-15(23-24)11-5-3-4-6-19-11/h3-9H,1-2H3,(H2,18,22,23) |
| InChIKey | ILBRKJBKDGCSCB-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C(=NC=N2)N3C(=NC(=N3)C4=CC=CC=N4)N)OC |
| Reference | <p style=/line-height:25px/> |
