For research use only. Not for therapeutic Use.
CP-601927(CAT: I006236) is a selective partial agonist of the α4β2 nicotinic acetylcholine receptor (nAChR), which is involved in modulating neurotransmitter release and cognitive processes. It has been investigated for its potential in treating conditions such as depression, anxiety, and cognitive disorders by enhancing cholinergic signaling in the brain. CP-601927 modulates nicotinic receptors in a way that may help alleviate symptoms related to mood and cognitive impairments, making it a valuable compound in neuropharmacology research. It offers promise in the development of novel therapeutic approaches for neuropsychiatric conditions, particularly those related to nicotinic receptor dysfunction.
CAS Number | 357425-02-6 |
Synonyms | (1S,8R)-4-(trifluoromethyl)-10-azatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene |
Molecular Formula | C12H12F3N |
Purity | ≥95% |
InChI | InChI=1S/C12H12F3N/c13-12(14,15)9-1-2-10-7-3-8(6-16-5-7)11(10)4-9/h1-2,4,7-8,16H,3,5-6H2/t7-,8+/m0/s1 |
InChIKey | RNOBTWYQAWEZHH-JGVFFNPUSA-N |
SMILES | C1C2CNCC1C3=C2C=CC(=C3)C(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |