For research use only. Not for therapeutic Use.
CP681301（Cat No.:I042871）is an investigational small molecule compound being studied for its potential in treating various cancers, particularly solid tumors. It acts as a potent inhibitor of the transforming growth factor-beta (TGF-β) signaling pathway, which plays a significant role in tumor progression, immune evasion, and metastasis. By blocking TGF-β receptors, CP681301 aims to disrupt tumor cell growth, inhibit metastasis, and enhance immune system function against cancer cells. Ongoing research is focused on evaluating its safety, pharmacokinetics, and efficacy in clinical trials, with the goal of improving cancer treatment outcomes, especially in resistant tumors.
| CAS Number | 865317-32-4 |
| Synonyms | N-(5-cyclobutyl-1H-pyrazol-3-yl)-2-[4-(dimethylamino)phenyl]acetamide |
| Molecular Formula | C17H22N4O |
| Purity | ≥95% |
| IUPAC Name | N-(5-cyclobutyl-1H-pyrazol-3-yl)-2-[4-(dimethylamino)phenyl]acetamide |
| InChI | InChI=1S/C17H22N4O/c1-21(2)14-8-6-12(7-9-14)10-17(22)18-16-11-15(19-20-16)13-4-3-5-13/h6-9,11,13H,3-5,10H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | PGTNTDKBRSQDNM-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)CC(=O)NC2=NNC(=C2)C3CCC3 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
