For research use only. Not for therapeutic Use.
CPI-455 hydrochloride(Cat No.:L013557), is a chemical compound used in biomedical research and pharmaceutical development. It is a hydrochloride salt form of CPI-455, a selective inhibitor of the protein lysine methyltransferase enzyme G9a. By inhibiting G9a, CPI-455 can modulate gene expression and impact cellular processes regulated by histone methylation. This compound has potential applications in epigenetic research and drug development for diseases where aberrant gene expression plays a role.
CAS Number | 2095432-28-1 |
Molecular Formula | C16H15ClN4O |
Purity | ≥95% |
Target | Histone Demethylase |
Storage | 2-8°C |
IUPAC Name | 7-oxo-5-phenyl-6-propan-2-yl-1H-pyrazolo[1,5-a]pyrimidine-3-carbonitrile;hydrochloride |
InChI | InChI=1S/C16H14N4O.ClH/c1-10(2)13-14(11-6-4-3-5-7-11)19-15-12(8-17)9-18-20(15)16(13)21;/h3-7,9-10,18H,1-2H3;1H |
InChIKey | SNODPNXOTKXHHH-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(N=C2C(=CNN2C1=O)C#N)C3=CC=CC=C3.Cl |