For research use only. Not for therapeutic Use.
CPI-613(Cat No.: I005683) is an experimental drug that acts as a mitochondrial inhibitor, specifically targeting cancer cells. It works by disrupting the metabolism of tumor cells, making them more vulnerable to treatment. CPI-613 interferes with enzymes involved in energy production within cancer cells, causing them to rely on less efficient metabolic pathways, ultimately leading to cell death. It’s primarily being explored in clinical trials for various cancers, including pancreatic cancer, and shows promise in enhancing the effects of chemotherapy and other treatments.
CAS Number | 95809-78-2 |
Synonyms | CPI613;CPI 613 |
Molecular Formula | C₂₂H₂₈O₂S₂ |
Purity | ≥95% |
Target | Metabolic Enzyme/Protease |
Solubility | 10 mM in DMSO |
Storage | 2-8°C |
IUPAC Name | 6,8-bis(benzylsulfanyl)octanoic acid |
InChI | InChI=1S/C22H28O2S2/c23-22(24)14-8-7-13-21(26-18-20-11-5-2-6-12-20)15-16-25-17-19-9-3-1-4-10-19/h1-6,9-12,21H,7-8,13-18H2,(H,23,24) |
InChIKey | ZYRLHJIMTROTBO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)CSCCC(CCCCC(=O)O)SCC2=CC=CC=C2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |