For research use only. Not for therapeutic Use.
CPUY192018（Cat No.:I025176）is a small molecule inhibitor that targets specific kinases involved in cellular signaling pathways. It has gained attention for its potential applications in cancer therapy due to its ability to block key enzymes responsible for tumor growth and metastasis. By inhibiting these kinases, CPUY192018 may help to halt the progression of various cancers. Research is ongoing to evaluate its effectiveness in preclinical models, its pharmacokinetic properties, and its safety profile. If successful, it could provide a new therapeutic option for patients with cancer resistant to current treatments.
| CAS Number | 1567836-15-0 |
| Synonyms | 2-[[4-[carboxymethyl-(4-methoxyphenyl)sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetic acid |
| Molecular Formula | C28H26N2O10S2 |
| Purity | ≥95% |
| IUPAC Name | 2-[[4-[carboxymethyl-(4-methoxyphenyl)sulfonylamino]naphthalen-1-yl]-(4-methoxyphenyl)sulfonylamino]acetic acid |
| InChI | InChI=1S/C28H26N2O10S2/c1-39-19-7-11-21(12-8-19)41(35,36)29(17-27(31)32)25-15-16-26(24-6-4-3-5-23(24)25)30(18-28(33)34)42(37,38)22-13-9-20(40-2)10-14-22/h3-16H,17-18H2,1-2H3,(H,31,32)(H,33,34) |
| InChIKey | KWSIQJUNYMMCTB-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC=C(C3=CC=CC=C32)N(CC(=O)O)S(=O)(=O)C4=CC=C(C=C4)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
