For research use only. Not for therapeutic Use.
CQ211（Cat No.:I043655）is a small molecule compound that has been investigated for its potential therapeutic applications, particularly in the field of cancer research. It is designed to target specific molecular pathways involved in tumor growth and progression. The compound has shown promise in preclinical studies for its ability to inhibit certain kinases or proteins associated with cancer cell survival. Further studies are needed to evaluate its efficacy, safety, and potential for clinical use. CQ211 could offer a novel treatment option for cancers that are resistant to conventional therapies.
| CAS Number | 2648986-65-4 |
| Synonyms | 8-(6-methoxypyridin-3-yl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-5H-triazolo[4,5-c]quinolin-4-one |
| Molecular Formula | C26H22F3N7O2 |
| Purity | ≥95% |
| IUPAC Name | 8-(6-methoxypyridin-3-yl)-1-[4-piperazin-1-yl-3-(trifluoromethyl)phenyl]-5H-triazolo[4,5-c]quinolin-4-one |
| InChI | InChI=1S/C26H22F3N7O2/c1-38-22-7-3-16(14-31-22)15-2-5-20-18(12-15)24-23(25(37)32-20)33-34-36(24)17-4-6-21(19(13-17)26(27,28)29)35-10-8-30-9-11-35/h2-7,12-14,30H,8-11H2,1H3,(H,32,37) |
| InChIKey | RGHLRMNPUGUZEY-UHFFFAOYSA-N |
| SMILES | COC1=NC=C(C=C1)C2=CC3=C(C=C2)NC(=O)C4=C3N(N=N4)C5=CC(=C(C=C5)N6CCNCC6)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
