CR-1-31-B (Cat No.:I015195) is a potent inhibitor of eIF4A RNA helicase, an enzyme involved in the translation initiation process. By targeting eIF4A, CR-1-31-B inhibits the translation of MUC1-C, a protein associated with breast cancer. In breast cancer cells, CR-1-31-B blocks MUC1-C translation in response to growth factor stimulation, leading to a decrease in MUC1-C abundance. This compound has shown efficacy in inhibiting MUC1-C expression in both normal and breast cancer cells. The inhibition of MUC1-C translation by CR-1-31-B represents a potential therapeutic approach for breast cancer treatment. Further research is underway to explore its clinical applications and potential as an anticancer agent.
| Catalog Number | I015195 |
| CAS Number | 1352914-52-3 |
| Molecular Formula | C₂₈H₂₉NO₈ |
| Purity | ≥95% |
| IUPAC Name | (1R,2R,3S,3aR,8bS)-1,8b-dihydroxy-N,6,8-trimethoxy-3a-(4-methoxyphenyl)-3-phenyl-2,3-dihydro-1H-cyclopenta[b][1]benzofuran-2-carboxamide |
| InChI | InChI=1S/C28H29NO8/c1-33-18-12-10-17(11-13-18)28-23(16-8-6-5-7-9-16)22(26(31)29-36-4)25(30)27(28,32)24-20(35-3)14-19(34-2)15-21(24)37-28/h5-15,22-23,25,30,32H,1-4H3,(H,29,31)/t22-,23-,25-,27+,28+/m1/s1 |
| InChIKey | KLSIFOJPWJBRFH-GWNOIRNCSA-N |
| SMILES | COC1=CC=C(C=C1)[C@]23[C@@H]([C@H]([C@H]([C@]2(C4=C(O3)C=C(C=C4OC)OC)O)O)C(=O)NOC)C5=CC=CC=C5 |
| Reference | [1]. Jin C, Rajabi H, Rodrigo CM, Porco JA Jr, Kufe D. Targeting the eIF4A RNA helicase blocks translation of the MUC1-C oncoprotein. Oncogene. 2013;32(17):2179-2188. |
