For research use only. Not for therapeutic Use.
CR-665(CAT: I006292) (also known as FE-200665 and JNJ-38488502) is a selective kappa-opioid receptor agonist being explored for its potential in treating postoperative pain. By targeting kappa-opioid receptors, it modulates pain perception without the central side effects commonly associated with mu-opioid agonists, such as respiratory depression or addiction risk. This compound is particularly valuable in pain management research, offering insights into alternative analgesic pathways. CR-665 serves as a critical tool for studying kappa-opioid receptor pharmacology and developing safer, non-addictive pain therapies for postoperative and chronic pain conditions.
| CAS Number | 958873-83-1 |
| Synonyms | CR-665; FE-200665; JNJ-38488502; CR665; FE200665; JNJ38488502; CR 665; FE 200665; JNJ 38488502;;(R)-2-((R)-2-((R)-2-amino-3-phenylpropanamido)-3-phenylpropanamido)-N-((R)-1-amino-5-guanidino-1-oxopentan-2-yl)-N-(pyridin-4-ylmethyl)hexanamide acetate |
| Molecular Formula | C38H53N9O6 |
| Purity | ≥95% |
| Target | kappa-opioid agonist |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| IUPAC Name | acetic acid;(2R)-2-[[(2R)-2-[[(2R)-2-amino-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-N-[(2R)-5-(diaminomethylideneamino)-1-oxo-1-(pyridin-4-ylmethylamino)pentan-2-yl]hexanamide |
| InChI | InChI=1S/C36H49N9O4.C2H4O2/c1-2-3-15-29(35(49)45(24-27-17-20-41-21-18-27)31(32(38)46)16-10-19-42-36(39)40)43-34(48)30(23-26-13-8-5-9-14-26)44-33(47)28(37)22-25-11-6-4-7-12-25;1-2(3)4/h4-9,11-14,17-18,20-21,28-31H,2-3,10,15-16,19,22-24,37H2,1H3,(H2,38,46)( |
| InChIKey | HJWCYDYBEQFBNK-CKYFGSNBSA-N |
| SMILES | N=C(N)NCCC[C@H](C(N)=O)N(C([C@@H](CCCC)NC([C@@H](CC1=CC=CC=C1)NC([C@@H](CC2=CC=CC=C2)N)=O)=O)=O)CC3=CC=NC=C3.CC(O)=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
