For research use only. Not for therapeutic Use.
Potent and selective CRAC ion channel inhibitor (or blocker). The compound inhibits the activity of CRAC ion channels and the production of IL-2, IL-4, IL-5, IL-13, GM-CSF, TNF-α, and IFNγ
| Catalog Number | I047573 |
| CAS Number | 944917-72-0 |
| Molecular Formula | C22H19F2N3OS |
| Purity | ≥95% |
| IUPAC Name | 2,6-difluoro-N-[4-[4-methyl-1-(1,3-thiazol-2-yl)-3,6-dihydro-2H-pyridin-5-yl]phenyl]benzamide |
| InChI | InChI=1S/C22H19F2N3OS/c1-14-9-11-27(22-25-10-12-29-22)13-17(14)15-5-7-16(8-6-15)26-21(28)20-18(23)3-2-4-19(20)24/h2-8,10,12H,9,11,13H2,1H3,(H,26,28) |
| SMILES | CC1=C(CN(CC1)C2=NC=CS2)C3=CC=C(C=C3)NC(=O)C4=C(C=CC=C4F)F |
| Reference | G Bohnert, S Chen and Y Xie. Preparation of vinyl phenyl compounds for treating inflammation and immune disorders. PCT Int. Appl. (2007), WO 2007087443 A2.
S Chen. Preparation of vinyl-aryl derivatives for inflammation and immune-related uses. PCT Int. Appl. (2009), WO 2009017831 A1. |
