For research use only. Not for therapeutic Use.
Cratoxylone（Cat No.:R072456）is a naturally occurring flavonoid compound isolated from plants, particularly in the Cratoxylum genus. Known for its diverse pharmacological properties, it exhibits significant antioxidant, anti-inflammatory, and antimicrobial activities. Cratoxylone protects cells from oxidative stress by scavenging free radicals and modulating inflammatory pathways, making it a potential candidate for managing chronic diseases. Additionally, its antimicrobial properties contribute to its use in combating infections. Ongoing research explores its role in drug development, highlighting cratoxylone’s potential as a bioactive compound in medicinal and pharmaceutical applications.
| Catalog Number | R072456 |
| CAS Number | 149155-01-1 |
| Molecular Formula | C24H28O7 |
| Purity | ≥95% |
| Target | Parasite |
| IUPAC Name | 1,3,6-trihydroxy-2-(3-hydroxy-3-methylbutyl)-7-methoxy-8-(3-methylbut-2-enyl)xanthen-9-one |
| InChI | InChI=1S/C24H28O7/c1-12(2)6-7-14-19-17(11-16(26)23(14)30-5)31-18-10-15(25)13(8-9-24(3,4)29)21(27)20(18)22(19)28/h6,10-11,25-27,29H,7-9H2,1-5H3 |
| InChIKey | JSXIWUDODLMCGG-UHFFFAOYSA-N |
| SMILES | CC(=CCC1=C(C(=CC2=C1C(=O)C3=C(O2)C=C(C(=C3O)CCC(C)(C)O)O)O)OC)C |
