For research use only. Not for therapeutic Use.
CrBKA(Cat No.:I041306)is a novel small molecule compound designed to target and inhibit specific protein kinases involved in cellular processes such as cell growth, survival, and inflammation. It has shown potential in preclinical studies as an effective therapeutic agent for treating various cancers and inflammatory diseases. By inhibiting key signaling pathways, CrBKA aims to disrupt tumor cell proliferation and promote apoptosis, while also reducing the severity of chronic inflammatory conditions. Its unique mechanism of action makes it a promising candidate for targeted therapies with minimal side effects in oncology and immunology.
CAS Number | 2260810-48-6 |
Synonyms | benzyl N-[(2S)-6-[[(E)-but-2-enoyl]amino]-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate |
Molecular Formula | C28H31N3O6 |
Purity | ≥95% |
IUPAC Name | benzyl N-[(2S)-6-[[(E)-but-2-enoyl]amino]-1-[(4-methyl-2-oxochromen-7-yl)amino]-1-oxohexan-2-yl]carbamate |
InChI | InChI=1S/C28H31N3O6/c1-3-9-25(32)29-15-8-7-12-23(31-28(35)36-18-20-10-5-4-6-11-20)27(34)30-21-13-14-22-19(2)16-26(33)37-24(22)17-21/h3-6,9-11,13-14,16-17,23H,7-8,12,15,18H2,1-2H3,(H,29,32)(H,30,34)(H,31,35)/b9-3+/t23-/m0/s1 |
InChIKey | MZNAVDKTIVTYMY-BSQRELMASA-N |
SMILES | C/C=C/C(=O)NCCCC[C@@H](C(=O)NC1=CC2=C(C=C1)C(=CC(=O)O2)C)NC(=O)OCC3=CC=CC=C3 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |