For research use only. Not for therapeutic Use.
Creatine riboside (Cat No.: I012699) is a novel form of creatine, a compound widely used to enhance physical performance and muscle energy. It consists of creatine bound to ribose, a sugar molecule, which helps improve the bioavailability and absorption of creatine in cells. This form of creatine is believed to have better efficacy in increasing cellular energy production and supporting muscle function compared to traditional creatine monohydrate. Creatine riboside is being studied for its potential benefits in athletic performance, cognitive function, and age-related muscle decline.
CAS Number | 1616693-92-5 |
Synonyms | 2-{2-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)-oxolan-2-yl]-1-methylcarbamimidamido}acetic acid |
Molecular Formula | C9H17N3O6 |
Purity | ≥95% |
Target | Endogenous Metabolite |
InChI | InChI=1S/C9H17N3O6/c1-12(2-5(14)15)9(10)11-8-7(17)6(16)4(3-13)18-8/h4,6-8,13,16-17H,2-3H2,1H3,(H2,10,11)(H,14,15)/t4-,6-,7-,8-/m1/s1 |
InChIKey | BGJFEKXALPJEGN-XVFCMESISA-N |
SMILES | CN(CC(=O)O)C(=NC1C(C(C(O1)CO)O)O)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |