Creatinine-13C is a high-purity carbon-13 labeled compound essential for advanced pharmaceutical and biochemical research. This isotopically labeled version of Creatinine, featuring a carbon-13 atom, is crucial for studies involving renal function, metabolic pathway analysis, and pharmacokinetics. Its stable isotope labeling ensures precise and reliable analytical results. With enhanced stability and consistency, it is suitable for various experimental setups. Ideal for kidney function research and drug development, Creatinine-13C integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | S000937 |
CAS Number | 1173022-95-1 |
Molecular Formula | C313CH7N3O |
Purity | 95% |
IUPAC Name | 2-amino-3-(113C)methyl-4H-imidazol-5-one |
InChI | InChI=1S/C4H7N3O/c1-7-2-3(8)6-4(7)5/h2H2,1H3,(H2,5,6,8)/i1+1 |
InChIKey | DDRJAANPRJIHGJ-OUBTZVSYSA-N |
SMILES | [13CH3]N1CC(=O)N=C1N |