For research use only. Not for therapeutic Use.
Crebanine（Cat No.:R016437）is an isoquinoline alkaloid derived from plants in the Stephania and Cyclea genera, known for its diverse pharmacological properties. It has demonstrated potential in various biological activities, including anti-inflammatory, antioxidant, and anticancer effects. Crebanine has also been studied for its ability to inhibit acetylcholinesterase, making it of interest in research related to neurodegenerative diseases such as Alzheimer’s. Additionally, its potential as an antimicrobial agent further broadens its therapeutic prospects. Its natural origin and versatile bioactivity make Crebanine a valuable compound in drug discovery and development research.
| Catalog Number | R016437 |
| CAS Number | 25127-29-1 |
| Molecular Formula | C20H21NO4 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 15,16-dimethoxy-11-methyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaene |
| InChI | InChI=1S/C20H21NO4/c1-21-7-6-11-8-16-20(25-10-24-16)18-12-4-5-15(22-2)19(23-3)13(12)9-14(21)17(11)18/h4-5,8,14H,6-7,9-10H2,1-3H3 |
| InChIKey | UVDQDNQWGQFIAO-UHFFFAOYSA-N |
| SMILES | CN1CCC2=CC3=C(C4=C2C1CC5=C4C=CC(=C5OC)OC)OCO3 |
