For research use only. Not for therapeutic Use.
Crebinostat（Cat No.:I025193）is a selective peptide inhibitor known for its potent activity in modulating histone deacetylases (HDACs), which play a crucial role in regulating gene expression and cellular processes. This compound has gained attention in cancer research due to its potential to induce cell cycle arrest, promote apoptosis, and enhance the efficacy of other cancer therapies. Crebinostat is also being studied for its impact on inflammation and immune responses. Preclinical trials are underway to evaluate its therapeutic potential in treating various cancers, as well as inflammatory and autoimmune diseases.
| CAS Number | 1092061-61-4 |
| Synonyms | N’-hydroxy-N-[(E)-(4-phenylphenyl)methylideneamino]heptanediamide |
| Molecular Formula | C20H23N3O3 |
| Purity | ≥95% |
| IUPAC Name | N'-hydroxy-N-[(E)-(4-phenylphenyl)methylideneamino]heptanediamide |
| InChI | InChI=1S/C20H23N3O3/c24-19(9-5-2-6-10-20(25)23-26)22-21-15-16-11-13-18(14-12-16)17-7-3-1-4-8-17/h1,3-4,7-8,11-15,26H,2,5-6,9-10H2,(H,22,24)(H,23,25)/b21-15+ |
| InChIKey | AEIVDBATQVVQFS-RCCKNPSSSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)/C=N/NC(=O)CCCCCC(=O)NO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
