For research use only. Not for therapeutic Use.
Cresyl Violet-d6 is a high-purity deuterated compound essential for advanced biochemical and pharmaceutical research. This isotopically labeled version of Cresyl Violet, featuring six deuterium atoms, is crucial for studies involving neuronal staining, cell viability assays, and histological examinations. Its stable isotope labeling ensures precise and reliable analytical results, providing enhanced stability and consistency in various experimental setups. Ideal for neurobiological research and diagnostic applications, Cresyl Violet-d6 integrates seamlessly into existing protocols, offering a robust and cost-effective solution for high-precision scientific investigations.
Catalog Number | R024931 |
CAS Number | NA |
Synonyms | 5-Amino-9-(dimethylamino)-10-methylbenzo[a]phenoxazin-7-ium Chloride-d6; 5-Imino-N,N,10-trimethyl-5H-benzo[a]phenoxazin-9-amine Monohydrochloride-d6; 9-(Dimethylamino)-5-imino-10-methyl-5H-benzo[a]phenoxazine Monohydrochloride-d6; Cresole Violet-d6 |
Molecular Formula | C₁₉H₁₂D₆ClN₃O |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | (5-amino-10-methylbenzo[a]phenoxazin-9-ylidene)-bis(trideuteriomethyl)azanium;chloride |
InChI | InChI=1S/C19H17N3O.ClH/c1-11-8-15-17(10-16(11)22(2)3)23-18-9-14(20)12-6-4-5-7-13(12)19(18)21-15;/h4-10,20H,1-3H3;1H/i2D3,3D3; |
InChIKey | ZHAFUINZIZIXFC-HVTBMTIBSA-N |
SMILES | [2H]C([2H])([2H])[N+](=C1C=C2C(=NC3=C(O2)C=C(C4=CC=CC=C43)N)C=C1C)C([2H])([2H])[2H].[Cl-] |