For research use only. Not for therapeutic Use.
Cridanimod is a small molecule that can increase progesterone receptor (PR) expression, with potential antineoplastic adjuvant activity. Cridanimod is able to induce the expression of PR in endometrial cancer. This could increase the sensitivity of endometrial cancer cells to progestin monotherapy. In combination with a progestin, cancer cells could be eradicated through increased PR-mediated signaling, leading to an inhibition of luteinizing hormone (LH) release from the pituitary gland, via a negative feedback mechanism, and, eventually, an inhibition of estrogen release from the ovaries. This leads to an inhibition of cellular growth in estrogen-dependent tumor cells.
| Catalog Number | I006296 |
| CAS Number | 38609-97-1 |
| Synonyms | Cridanimod;2-(9-oxoacridin-10(9H)-yl)acetic acid |
| Molecular Formula | C15H11NO3 |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| IUPAC Name | 2-(9-oxoacridin-10-yl)acetic acid |
| InChI | InChI=1S/C15H11NO3/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16/h1-8H,9H2,(H,17,18) |
| InChIKey | UOMKBIIXHQIERR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3N2CC(=O)O |
