For research use only. Not for therapeutic Use.
Cridanimod(CAT: I006296) is a small-molecule immunomodulator with applications in oncology and immunology research. It functions by inducing the expression of progesterone receptors and stimulating interferon production, offering potential in studying hormone-responsive cancers and immune-mediated therapies. Researchers utilize Cridanimod to investigate its role in enhancing the efficacy of progestin-based treatments for endometrial cancer and exploring its immunomodulatory effects in various cancer types. With its unique dual action, Cridanimod serves as a valuable tool for preclinical studies aimed at advancing cancer immunotherapy and hormonal treatment strategies.
| Catalog Number | I006296 |
| CAS Number | 38609-97-1 |
| Synonyms | Cridanimod;2-(9-oxoacridin-10(9H)-yl)acetic acid |
| Molecular Formula | C15H11NO3 |
| Purity | ≥95% |
| Target | Immunology/Inflammation |
| Solubility | Soluble in DMSO, not in water |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| IUPAC Name | 2-(9-oxoacridin-10-yl)acetic acid |
| InChI | InChI=1S/C15H11NO3/c17-14(18)9-16-12-7-3-1-5-10(12)15(19)11-6-2-4-8-13(11)16/h1-8H,9H2,(H,17,18) |
| InChIKey | UOMKBIIXHQIERR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=CC=CC=C3N2CC(=O)O |
