For research use only. Not for therapeutic Use.
Crotonoyl coenzyme A trilithium salt(Cat No.:M004261) is a biologically significant compound that functions as an intermediate in metabolic pathways, particularly in fatty acid metabolism and the β-oxidation cycle. This specific form features the protocol group linked to coenzyme A, a key molecule in energy production and synthesis processes within cells, stabilized by three lithium ions. The addition of lithium helps enhance the solubility and stability of the compound, facilitating its use in biochemical studies and research. Crotonoyl CoA is crucial for studying enzyme mechanisms and metabolic pathways that involve lipid degradation and energy conversion.
CAS Number | 102680-35-3 |
Molecular Formula | C25H37Li3N7O17P3S1 |
Purity | ≥95% |
Storage | Desiccate at RT |
InChI | InChI=1S/C25H40N7O17P3S.Li/c1-4-5-16(34)53-9-8-27-15(33)6-7-28-23(37)20(36)25(2,3)11-46-52(43,44)49-51(41,42)45-10-14-19(48-50(38,39)40)18(35)24(47-14)32-13-31-17-21(26)29-12-30-22(17)32;/h4-5,12-14,18-20,24,35-36H,6-11H2,1-3H3,(H,27,33)(H,28,37)(H,41,42)(H,43,44)(H2,26,29,30)(H2,38,39,40);/b5-4+;/t14-,18-,19-,20+,24-;/m1./s1 |
InChIKey | VVVNZHYHSLNWDW-CVPWVEIMSA-N |
SMILES | [Li].CC=CC(=O)SCCNC(=O)CCNC(=O)C(C(C)(C)COP(=O)(O)OP(=O)(O)OCC1C(C(C(O1)N2C=NC3=C(N=CN=C32)N)O)OP(=O)(O)O)O |