For research use only. Not for therapeutic Use.
CRT0105950（Cat No.:I025223）is a selective small molecule inhibitor developed to target specific proteins involved in cancer cell survival and proliferation. It primarily focuses on modulating key pathways that drive tumor growth, such as those related to protein synthesis and cellular stress response. Preclinical studies suggest that CRT0105950 may have potential in treating various types of cancers, particularly those resistant to traditional treatments. Ongoing research aims to further explore its pharmacological properties, therapeutic efficacy, and safety profile, with the hope of advancing it into clinical trials for cancer patients.
| CAS Number | 1661845-86-8 |
| Synonyms | 4-[[5-[3-(2-chloro-4-methylphenyl)pyridin-4-yl]-1,3-thiazol-2-yl]amino]phenol |
| Molecular Formula | C21H16ClN3OS |
| Purity | ≥95% |
| IUPAC Name | 4-[[5-[3-(2-chloro-4-methylphenyl)pyridin-4-yl]-1,3-thiazol-2-yl]amino]phenol |
| InChI | InChI=1S/C21H16ClN3OS/c1-13-2-7-16(19(22)10-13)18-11-23-9-8-17(18)20-12-24-21(27-20)25-14-3-5-15(26)6-4-14/h2-12,26H,1H3,(H,24,25) |
| InChIKey | QYDBOFPHPMYWDO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C2=C(C=CN=C2)C3=CN=C(S3)NC4=CC=C(C=C4)O)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
